C23H34N2 — CID 123752645
1-(2,4,5,6-tetramethylcyclohexa-1,3-dien-1-yl)-3-(2,4,6,6-tetramethylcyclohexa-1,3-dien-1-yl)-2H-imidazole (PubChem CID 123752645) has the molecular formula C23H34N2 and a molecular weight of 338.54 g/mol. Its IUPAC name is 1-(2,4,5,6-tetramethylcyclohexa-1,3-dien-1-yl)-3-(2,4,6,6-tetramethylcyclohexa-1,3-dien-1-yl)-2H-imidazole.
| Compound Name | 1-(2,4,5,6-tetramethylcyclohexa-1,3-dien-1-yl)-3-(2,4,6,6-tetramethylcyclohexa-1,3-dien-1-yl)-2H-imidazole |
|---|---|
| PubChem CID | 123752645 |
| Molecular Formula | C23H34N2 |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.27 |
| IUPAC Name | 1-(2,4,5,6-tetramethylcyclohexa-1,3-dien-1-yl)-3-(2,4,6,6-tetramethylcyclohexa-1,3-dien-1-yl)-2H-imidazole |
| SMILES | CC1=CC(C)=C(N2C=CN(C3=C(C)C=C(C)C(C)C3C)C2)C(C)(C)C1 |
| InChI | InChI=1S/C23H34N2/c1-15-11-18(4)22(23(7,8)13-15)25-10-9-24(14-25)21-17(3)12-16(2)19(5)20(21)6/h9-12,19-20H,13-14H2,1-8H3 |
| InChIKey | PIRITSIIQRKALH-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |