C18H34N2 — CID 123647516
3,4-diethyl-N,N,1,3,4,6-hexamethyl-5-prop-1-enyl-2H-pyridin-2-amine (PubChem CID 123647516) has the molecular formula C18H34N2 and a molecular weight of 278.48 g/mol. Its IUPAC name is 3,4-diethyl-N,N,1,3,4,6-hexamethyl-5-prop-1-enyl-2H-pyridin-2-amine.
| Compound Name | 3,4-diethyl-N,N,1,3,4,6-hexamethyl-5-prop-1-enyl-2H-pyridin-2-amine |
|---|---|
| PubChem CID | 123647516 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | 3,4-diethyl-N,N,1,3,4,6-hexamethyl-5-prop-1-enyl-2H-pyridin-2-amine |
| SMILES | CC=CC1=C(C)N(C)C(N(C)C)C(C)(CC)C1(C)CC |
| InChI | InChI=1S/C18H34N2/c1-10-13-15-14(4)20(9)16(19(7)8)18(6,12-3)17(15,5)11-2/h10,13,16H,11-12H2,1-9H3 |
| InChIKey | KMYKLGJJDNKROQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |