C20H31N3 — CID 123633675
2-[(7,8-diethyl-1,5,7,8-tetramethyl-8aH-imidazo[1,2-a]pyridin-6-yl)methylidene]butanenitrile (PubChem CID 123633675) has the molecular formula C20H31N3 and a molecular weight of 313.49 g/mol. Its IUPAC name is 2-[(7,8-diethyl-1,5,7,8-tetramethyl-8aH-imidazo[1,2-a]pyridin-6-yl)methylidene]butanenitrile.
| Compound Name | 2-[(7,8-diethyl-1,5,7,8-tetramethyl-8aH-imidazo[1,2-a]pyridin-6-yl)methylidene]butanenitrile |
|---|---|
| PubChem CID | 123633675 |
| Molecular Formula | C20H31N3 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | 2-[(7,8-diethyl-1,5,7,8-tetramethyl-8aH-imidazo[1,2-a]pyridin-6-yl)methylidene]butanenitrile |
| SMILES | CCC(C#N)=CC1=C(C)N2C=CN(C)C2C(C)(CC)C1(C)CC |
| InChI | InChI=1S/C20H31N3/c1-8-16(14-21)13-17-15(4)23-12-11-22(7)18(23)20(6,10-3)19(17,5)9-2/h11-13,18H,8-10H2,1-7H3 |
| InChIKey | OINMGSOCKQTOGQ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|