C15H22N2 — CID 129035069
2,4,6,10-tetramethyl-5-[(Z)-prop-1-enyl]-7,10-diazatricyclo[5.3.0.02,4]deca-5,8-diene (PubChem CID 129035069) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2,4,6,10-tetramethyl-5-[(Z)-prop-1-enyl]-7,10-diazatricyclo[5.3.0.02,4]deca-5,8-diene.
| Compound Name | 2,4,6,10-tetramethyl-5-[(Z)-prop-1-enyl]-7,10-diazatricyclo[5.3.0.02,4]deca-5,8-diene |
|---|---|
| PubChem CID | 129035069 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2,4,6,10-tetramethyl-5-[(Z)-prop-1-enyl]-7,10-diazatricyclo[5.3.0.02,4]deca-5,8-diene |
| SMILES | C/C=C\C1=C(C)N2C=CN(C)C2C2(C)CC12C |
| InChI | InChI=1S/C15H22N2/c1-6-7-12-11(2)17-9-8-16(5)13(17)15(4)10-14(12,15)3/h6-9,13H,10H2,1-5H3/b7-6- |
| InChIKey | FYDIBYQTKUCCCN-SREVYHEPSA-N |
| XLogP | 3.31 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |