C20H30N2 — CID 129109378
(5E)-8-ethenyl-7,8-diethyl-1,7-dimethyl-5-[(2Z)-penta-2,4-dienylidene]-6,8a-dihydroimidazo[1,2-a]pyridine (PubChem CID 129109378) has the molecular formula C20H30N2 and a molecular weight of 298.47 g/mol. Its IUPAC name is (5E)-8-ethenyl-7,8-diethyl-1,7-dimethyl-5-[(2Z)-penta-2,4-dienylidene]-6,8a-dihydroimidazo[1,2-a]pyridine.
| Compound Name | (5E)-8-ethenyl-7,8-diethyl-1,7-dimethyl-5-[(2Z)-penta-2,4-dienylidene]-6,8a-dihydroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 129109378 |
| Molecular Formula | C20H30N2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | (5E)-8-ethenyl-7,8-diethyl-1,7-dimethyl-5-[(2Z)-penta-2,4-dienylidene]-6,8a-dihydroimidazo[1,2-a]pyridine |
| SMILES | C=C/C=C\C=C1/CC(C)(CC)C(C=C)(CC)C2N(C)C=CN12 |
| InChI | InChI=1S/C20H30N2/c1-7-11-12-13-17-16-19(5,8-2)20(9-3,10-4)18-21(6)14-15-22(17)18/h7,9,11-15,18H,1,3,8,10,16H2,2,4-6H3/b12-11-,17-13+ |
| InChIKey | MLJBQDUWMCKNPO-WCVKEAJASA-N |
| XLogP | 5.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|