C20H37N — CID 88928009
2,3,3,7-tetramethyl-N-[(3E)-penta-1,3-dien-2-yl]-N-propyloct-6-en-1-amine (PubChem CID 88928009) has the molecular formula C20H37N and a molecular weight of 291.52 g/mol. Its IUPAC name is 2,3,3,7-tetramethyl-N-[(3E)-penta-1,3-dien-2-yl]-N-propyloct-6-en-1-amine.
| Compound Name | 2,3,3,7-tetramethyl-N-[(3E)-penta-1,3-dien-2-yl]-N-propyloct-6-en-1-amine |
|---|---|
| PubChem CID | 88928009 |
| Molecular Formula | C20H37N |
| Molecular Weight | 291.52 g/mol |
| Exact Mass | 291.29 |
| IUPAC Name | 2,3,3,7-tetramethyl-N-[(3E)-penta-1,3-dien-2-yl]-N-propyloct-6-en-1-amine |
| SMILES | C=C(/C=C/C)N(CCC)CC(C)C(C)(C)CCC=C(C)C |
| InChI | InChI=1S/C20H37N/c1-9-12-19(6)21(15-10-2)16-18(5)20(7,8)14-11-13-17(3)4/h9,12-13,18H,6,10-11,14-16H2,1-5,7-8H3/b12-9+ |
| InChIKey | YFMSIPOOGQMKGJ-FMIVXFBMSA-N |
| XLogP | 6.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.52 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|