C10H8Cl2N2O3 — CID 162095352
3-(3,5-dichloro-2,4-dihydroxyphenyl)-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 162095352) has the molecular formula C10H8Cl2N2O3 and a molecular weight of 275.09 g/mol. Its IUPAC name is 3-(3,5-dichloro-2,4-dihydroxyphenyl)-4,5-dihydro-1H-pyridazin-6-one.
| Compound Name | 3-(3,5-dichloro-2,4-dihydroxyphenyl)-4,5-dihydro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 162095352 |
| Molecular Formula | C10H8Cl2N2O3 |
| Molecular Weight | 275.09 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 3-(3,5-dichloro-2,4-dihydroxyphenyl)-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | O=C1CCC(c2cc(Cl)c(O)c(Cl)c2O)=NN1 |
| InChI | InChI=1S/C10H8Cl2N2O3/c11-5-3-4(9(16)8(12)10(5)17)6-1-2-7(15)14-13-6/h3,16-17H,1-2H2,(H,14,15) |
| InChIKey | ZEEDEPDDAPCXIK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.09 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'} |
|---|