About nickel;4-[[8-(pyridin-2-yldiazenyl)quinolin-5-yl]amino]benzoic acid
nickel;4-[[8-(pyridin-2-yldiazenyl)quinolin-5-yl]amino]benzoic acid (PubChem CID 162103797) has the molecular formula C21H15N5NiO2
and a molecular weight of 428.08 g/mol. Its IUPAC name is nickel;4-[[8-(pyridin-2-yldiazenyl)quinolin-5-yl]amino]benzoic acid.
Molecular Properties
| Compound Name | nickel;4-[[8-(pyridin-2-yldiazenyl)quinolin-5-yl]amino]benzoic acid |
| PubChem CID | 162103797 |
| Molecular Formula | C21H15N5NiO2 |
| Molecular Weight | 428.08 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | nickel;4-[[8-(pyridin-2-yldiazenyl)quinolin-5-yl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2ccc(/N=N/c3ccccn3)c3ncccc23)cc1.[Ni] |
| InChI | InChI=1S/C21H15N5O2.Ni/c27-21(28)14-6-8-15(9-7-14)24-17-10-11-18(20-16(17)4-3-13-23-20)25-26-19-5-1-2-12-22-19;/h1-13,24H,(H,27,28);/b26-25+; |
| InChIKey | ZFFVZRAKSJQIOD-BTKVJIOYSA-N |
| XLogP | 5.48 |
| TPSA | 99.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.08 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze nickel;4-[[8-(pyridin-2-yldiazenyl)quinolin-5-yl]amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel;4-[[8-(pyridin-2-yldiazenyl)quinolin-5-yl]amino]benzoic acid?
The IUPAC name of nickel;4-[[8-(pyridin-2-yldiazenyl)quinolin-5-yl]amino]benzoic acid (CID 162103797) is nickel;4-[[8-(pyridin-2-yldiazenyl)quinolin-5-yl]amino]benzoic acid.
What is the SMILES notation for nickel;4-[[8-(pyridin-2-yldiazenyl)quinolin-5-yl]amino]benzoic acid?
The canonical SMILES for nickel;4-[[8-(pyridin-2-yldiazenyl)quinolin-5-yl]amino]benzoic acid is O=C(O)c1ccc(Nc2ccc(/N=N/c3ccccn3)c3ncccc23)cc1.[Ni].
What is the InChIKey of nickel;4-[[8-(pyridin-2-yldiazenyl)quinolin-5-yl]amino]benzoic acid?
The InChIKey is ZFFVZRAKSJQIOD-BTKVJIOYSA-N. The full InChI is InChI=1S/C21H15N5O2.Ni/c27-21(28)14-6-8-15(9-7-14)24-17-10-11-18(20-16(17)4-3-13-23-20)25-26-19-5-1-2-12-22-19;/h1-13,24H,(H,27,28);/b26-25+;.
What are the key properties of nickel;4-[[8-(pyridin-2-yldiazenyl)quinolin-5-yl]amino]benzoic acid?
nickel;4-[[8-(pyridin-2-yldiazenyl)quinolin-5-yl]amino]benzoic acid has a molecular weight of 428.08 g/mol, XLogP of 5.48, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for nickel;4-[[8-(pyridin-2-yldiazenyl)quinolin-5-yl]amino]benzoic acid is sourced from PubChem (CID 162103797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).