C20H20N+ — CID 162107173
1-methyl-2-(2-methyl-8a,9-dihydro-4bH-fluoren-1-yl)pyridin-1-ium (PubChem CID 162107173) has the molecular formula C20H20N+ and a molecular weight of 274.39 g/mol. Its IUPAC name is 1-methyl-2-(2-methyl-8a,9-dihydro-4bH-fluoren-1-yl)pyridin-1-ium.
| Compound Name | 1-methyl-2-(2-methyl-8a,9-dihydro-4bH-fluoren-1-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 162107173 |
| Molecular Formula | C20H20N+ |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 1-methyl-2-(2-methyl-8a,9-dihydro-4bH-fluoren-1-yl)pyridin-1-ium |
| SMILES | Cc1ccc2c(c1-c1cccc[n+]1C)CC1C=CC=CC21 |
| InChI | InChI=1S/C20H20N/c1-14-10-11-17-16-8-4-3-7-15(16)13-18(17)20(14)19-9-5-6-12-21(19)2/h3-12,15-16H,13H2,1-2H3/q+1 |
| InChIKey | WRWDDJBNJFLHIJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|