C30H42N2O2 — CID 162110812
2-methyl-N-[(8Z,11Z,14Z,17Z,20Z)-4-oxotricosa-8,11,14,17,20-pentaenyl]pyridine-3-carboxamide (PubChem CID 162110812) has the molecular formula C30H42N2O2 and a molecular weight of 462.68 g/mol. Its IUPAC name is 2-methyl-N-[(8Z,11Z,14Z,17Z,20Z)-4-oxotricosa-8,11,14,17,20-pentaenyl]pyridine-3-carboxamide.
| Compound Name | 2-methyl-N-[(8Z,11Z,14Z,17Z,20Z)-4-oxotricosa-8,11,14,17,20-pentaenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 162110812 |
| Molecular Formula | C30H42N2O2 |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | 2-methyl-N-[(8Z,11Z,14Z,17Z,20Z)-4-oxotricosa-8,11,14,17,20-pentaenyl]pyridine-3-carboxamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)CCCNC(=O)c1cccnc1C |
| InChI | InChI=1S/C30H42N2O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-28(33)23-20-26-32-30(34)29-24-21-25-31-27(29)2/h4-5,7-8,10-11,13-14,16-17,21,24-25H,3,6,9,12,15,18-20,22-23,26H2,1-2H3,(H,32,34)/b5-4-,8-7-,11-10-,14-13-,17-16- |
| InChIKey | ZGCYJGDMUFEETE-JEBPEJKESA-N |
| XLogP | 7.39 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|