C27H55NO5 — CID 162119756
2-(diethylamino)ethanol;2,3-dihydroxypropyl (Z)-octadec-9-enoate (PubChem CID 162119756) has the molecular formula C27H55NO5 and a molecular weight of 473.74 g/mol. Its IUPAC name is 2-(diethylamino)ethanol;2,3-dihydroxypropyl (Z)-octadec-9-enoate.
| Compound Name | 2-(diethylamino)ethanol;2,3-dihydroxypropyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 162119756 |
| Molecular Formula | C27H55NO5 |
| Molecular Weight | 473.74 g/mol |
| Exact Mass | 473.41 |
| IUPAC Name | 2-(diethylamino)ethanol;2,3-dihydroxypropyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(O)CO.CCN(CC)CCO |
| InChI | InChI=1S/C21H40O4.C6H15NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22;1-3-7(4-2)5-6-8/h9-10,20,22-23H,2-8,11-19H2,1H3;8H,3-6H2,1-2H3/b10-9-; |
| InChIKey | ZHGCQSOSOMSBCS-KVVVOXFISA-N |
| XLogP | 5.24 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.74 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|