C17H33NO6 — CID 162122110
methane;3-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]propyl 4-methylpiperidine-1-carboxylate (PubChem CID 162122110) has the molecular formula C17H33NO6 and a molecular weight of 347.45 g/mol. Its IUPAC name is methane;3-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]propyl 4-methylpiperidine-1-carboxylate.
| Compound Name | methane;3-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]propyl 4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 162122110 |
| Molecular Formula | C17H33NO6 |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | methane;3-[(2S,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]propyl 4-methylpiperidine-1-carboxylate |
| SMILES | C.CC1CCN(C(=O)OCCC[C@@H]2O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]2O)CC1 |
| InChI | InChI=1S/C16H29NO6.CH4/c1-10-5-7-17(8-6-10)16(21)22-9-3-4-12-14(19)15(20)13(18)11(2)23-12;/h10-15,18-20H,3-9H2,1-2H3;1H4/t11-,12-,13+,14+,15+;/m0./s1 |
| InChIKey | ZHNXRUAZKLYCNU-ASQHYVISSA-N |
| XLogP | 1.14 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|