About 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]propyl 4-acetylpiperidine-1-carboxylate;methane
3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]propyl 4-acetylpiperidine-1-carboxylate;methane (PubChem CID 157055858) has the molecular formula C17H31NO7
and a molecular weight of 361.44 g/mol. Its IUPAC name is 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]propyl 4-acetylpiperidine-1-carboxylate;methane.
Molecular Properties
| Compound Name | 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]propyl 4-acetylpiperidine-1-carboxylate;methane |
| PubChem CID | 157055858 |
| Molecular Formula | C17H31NO7 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]propyl 4-acetylpiperidine-1-carboxylate;methane |
| SMILES | C.CC(=O)C1CCN(C(=O)OCCCC2OC(CO)C(O)C2O)CC1 |
| InChI | InChI=1S/C16H27NO7.CH4/c1-10(19)11-4-6-17(7-5-11)16(22)23-8-2-3-12-14(20)15(21)13(9-18)24-12;/h11-15,18,20-21H,2-9H2,1H3;1H4 |
| InChIKey | AATAGRNVWWWFTH-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]propyl 4-acetylpiperidine-1-carboxylate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]propyl 4-acetylpiperidine-1-carboxylate;methane?
The IUPAC name of 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]propyl 4-acetylpiperidine-1-carboxylate;methane (CID 157055858) is 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]propyl 4-acetylpiperidine-1-carboxylate;methane.
What is the SMILES notation for 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]propyl 4-acetylpiperidine-1-carboxylate;methane?
The canonical SMILES for 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]propyl 4-acetylpiperidine-1-carboxylate;methane is C.CC(=O)C1CCN(C(=O)OCCCC2OC(CO)C(O)C2O)CC1.
What is the InChIKey of 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]propyl 4-acetylpiperidine-1-carboxylate;methane?
The InChIKey is AATAGRNVWWWFTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO7.CH4/c1-10(19)11-4-6-17(7-5-11)16(22)23-8-2-3-12-14(20)15(21)13(9-18)24-12;/h11-15,18,20-21H,2-9H2,1H3;1H4.
What are the key properties of 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]propyl 4-acetylpiperidine-1-carboxylate;methane?
3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]propyl 4-acetylpiperidine-1-carboxylate;methane has a molecular weight of 361.44 g/mol, XLogP of 0.32, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]propyl 4-acetylpiperidine-1-carboxylate;methane is sourced from PubChem (CID 157055858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).