C17H31NO7 — CID 157055858
3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]propyl 4-acetylpiperidine-1-carboxylate;methane (PubChem CID 157055858) has the molecular formula C17H31NO7 and a molecular weight of 361.44 g/mol. Its IUPAC name is 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]propyl 4-acetylpiperidine-1-carboxylate;methane.
| Compound Name | 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]propyl 4-acetylpiperidine-1-carboxylate;methane |
|---|---|
| PubChem CID | 157055858 |
| Molecular Formula | C17H31NO7 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]propyl 4-acetylpiperidine-1-carboxylate;methane |
| SMILES | C.CC(=O)C1CCN(C(=O)OCCCC2OC(CO)C(O)C2O)CC1 |
| InChI | InChI=1S/C16H27NO7.CH4/c1-10(19)11-4-6-17(7-5-11)16(22)23-8-2-3-12-14(20)15(21)13(9-18)24-12;/h11-15,18,20-21H,2-9H2,1H3;1H4 |
| InChIKey | AATAGRNVWWWFTH-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|