C36H63Br2N3O11 — CID 162124970
[2,2-bis[(2-bromo-2-methylpropanoyl)oxymethyl]-3-[5-[2-[(5S)-5,11-diamino-11-imino-4-oxoundecoxy]ethoxy]-2-oxopentoxy]propyl] 2,2-dimethylpropanoate (PubChem CID 162124970) has the molecular formula C36H63Br2N3O11 and a molecular weight of 873.72 g/mol. Its IUPAC name is [2,2-bis[(2-bromo-2-methylpropanoyl)oxymethyl]-3-[5-[2-[(5S)-5,11-diamino-11-imino-4-oxoundecoxy]ethoxy]-2-oxopentoxy]propyl] 2,2-dimethylpropanoate.
| Compound Name | [2,2-bis[(2-bromo-2-methylpropanoyl)oxymethyl]-3-[5-[2-[(5S)-5,11-diamino-11-imino-4-oxoundecoxy]ethoxy]-2-oxopentoxy]propyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 162124970 |
| Molecular Formula | C36H63Br2N3O11 |
| Molecular Weight | 873.72 g/mol |
| Exact Mass | 871.28 |
| IUPAC Name | [2,2-bis[(2-bromo-2-methylpropanoyl)oxymethyl]-3-[5-[2-[(5S)-5,11-diamino-11-imino-4-oxoundecoxy]ethoxy]-2-oxopentoxy]propyl] 2,2-dimethylpropanoate |
| SMILES | [H]/N=C(\N)CCCCC[C@H](N)C(=O)CCCOCCOCCCC(=O)COCC(COC(=O)C(C)(C)C)(COC(=O)C(C)(C)Br)COC(=O)C(C)(C)Br |
| InChI | InChI=1S/C36H63Br2N3O11/c1-33(2,3)30(44)50-23-36(24-51-31(45)34(4,5)37,25-52-32(46)35(6,7)38)22-49-21-26(42)13-11-17-47-19-20-48-18-12-15-28(43)27(39)14-9-8-10-16-29(40)41/h27H,8-25,39H2,1-7H3,(H3,40,41)/t27-/m0/s1 |
| InChIKey | DJOOFHDTQVDIDA-MHZLTWQESA-N |
| XLogP | 4.96 |
| TPSA | 216.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.72 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|