C22H29O2S+ — CID 162128823
bis(2,4-dimethylphenyl)-(1-ethoxy-1-oxobutan-2-yl)sulfanium (PubChem CID 162128823) has the molecular formula C22H29O2S+ and a molecular weight of 357.54 g/mol. Its IUPAC name is bis(2,4-dimethylphenyl)-(1-ethoxy-1-oxobutan-2-yl)sulfanium.
| Compound Name | bis(2,4-dimethylphenyl)-(1-ethoxy-1-oxobutan-2-yl)sulfanium |
|---|---|
| PubChem CID | 162128823 |
| Molecular Formula | C22H29O2S+ |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | bis(2,4-dimethylphenyl)-(1-ethoxy-1-oxobutan-2-yl)sulfanium |
| SMILES | CCOC(=O)C(CC)[S+](c1ccc(C)cc1C)c1ccc(C)cc1C |
| InChI | InChI=1S/C22H29O2S/c1-7-19(22(23)24-8-2)25(20-11-9-15(3)13-17(20)5)21-12-10-16(4)14-18(21)6/h9-14,19H,7-8H2,1-6H3/q+1 |
| InChIKey | NJEWKHNCRIBEKD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|