C28H56N4O4S — CID 162131322
N-(10-amino-2,9-dioxotridecan-3-yl)-2-ethylsulfanylacetamide;2-amino-N-propyloctanamide (PubChem CID 162131322) has the molecular formula C28H56N4O4S and a molecular weight of 544.85 g/mol. Its IUPAC name is N-(10-amino-2,9-dioxotridecan-3-yl)-2-ethylsulfanylacetamide;2-amino-N-propyloctanamide.
| Compound Name | N-(10-amino-2,9-dioxotridecan-3-yl)-2-ethylsulfanylacetamide;2-amino-N-propyloctanamide |
|---|---|
| PubChem CID | 162131322 |
| Molecular Formula | C28H56N4O4S |
| Molecular Weight | 544.85 g/mol |
| Exact Mass | 544.40 |
| IUPAC Name | N-(10-amino-2,9-dioxotridecan-3-yl)-2-ethylsulfanylacetamide;2-amino-N-propyloctanamide |
| SMILES | CCCC(N)C(=O)CCCCCC(NC(=O)CSCC)C(C)=O.CCCCCCC(N)C(=O)NCCC |
| InChI | InChI=1S/C17H32N2O3S.C11H24N2O/c1-4-9-14(18)16(21)11-8-6-7-10-15(13(3)20)19-17(22)12-23-5-2;1-3-5-6-7-8-10(12)11(14)13-9-4-2/h14-15H,4-12,18H2,1-3H3,(H,19,22);10H,3-9,12H2,1-2H3,(H,13,14) |
| InChIKey | ZIRWSPAXAWVTNP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.85 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|