C32H57N8O6+ — CID 162142436
tert-butyl 3-amino-6,6-dimethyl-2-(propoxymethyl)-3a,4-dihydropyrrolo[3,4-c]pyrazol-2-ium-5-carboxylate;tert-butyl 3-amino-6,6-dimethyl-1-(propoxymethyl)-4H-pyrrolo[3,4-d]pyrazole-5-carboxylate (PubChem CID 162142436) has the molecular formula C32H57N8O6+ and a molecular weight of 649.86 g/mol. Its IUPAC name is tert-butyl 3-amino-6,6-dimethyl-2-(propoxymethyl)-3a,4-dihydropyrrolo[3,4-c]pyrazol-2-ium-5-carboxylate;tert-butyl 3-amino-6,6-dimethyl-1-(propoxymethyl)-4H-pyrrolo[3,4-d]pyrazole-5-carboxylate.
| Compound Name | tert-butyl 3-amino-6,6-dimethyl-2-(propoxymethyl)-3a,4-dihydropyrrolo[3,4-c]pyrazol-2-ium-5-carboxylate;tert-butyl 3-amino-6,6-dimethyl-1-(propoxymethyl)-4H-pyrrolo[3,4-d]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 162142436 |
| Molecular Formula | C32H57N8O6+ |
| Molecular Weight | 649.86 g/mol |
| Exact Mass | 649.44 |
| IUPAC Name | tert-butyl 3-amino-6,6-dimethyl-2-(propoxymethyl)-3a,4-dihydropyrrolo[3,4-c]pyrazol-2-ium-5-carboxylate;tert-butyl 3-amino-6,6-dimethyl-1-(propoxymethyl)-4H-pyrrolo[3,4-d]pyrazole-5-carboxylate |
| SMILES | CCCOC[N+]1=C(N)C2CN(C(=O)OC(C)(C)C)C(C)(C)C2=N1.CCCOCn1nc(N)c2c1C(C)(C)N(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/2C16H28N4O3/c1-7-8-22-10-20-12-11(13(17)18-20)9-19(16(12,5)6)14(21)23-15(2,3)4;1-7-8-22-10-20-13(17)11-9-19(14(21)23-15(2,3)4)16(5,6)12(11)18-20/h7-10H2,1-6H3,(H2,17,18);11,17H,7-10H2,1-6H3/p+1 |
| InChIKey | KGIZDVVDTJPDEB-UHFFFAOYSA-O |
| XLogP | 4.59 |
| TPSA | 162.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.86 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|