C36H44N2O2 — CID 162143843
1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-trien-2-one;5,11b,12,13-tetrahydroisoindolo[2,3-b][2]benzazepin-7-one;ethane (PubChem CID 162143843) has the molecular formula C36H44N2O2 and a molecular weight of 536.76 g/mol. Its IUPAC name is 1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-trien-2-one;5,11b,12,13-tetrahydroisoindolo[2,3-b][2]benzazepin-7-one;ethane.
| Compound Name | 1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-trien-2-one;5,11b,12,13-tetrahydroisoindolo[2,3-b][2]benzazepin-7-one;ethane |
|---|---|
| PubChem CID | 162143843 |
| Molecular Formula | C36H44N2O2 |
| Molecular Weight | 536.76 g/mol |
| Exact Mass | 536.34 |
| IUPAC Name | 1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8-trien-2-one;5,11b,12,13-tetrahydroisoindolo[2,3-b][2]benzazepin-7-one;ethane |
| SMILES | CC.CC.O=C1CCc2cccc3c2N1C1CCCCC31.O=C1c2ccccc2C2CCc3ccccc3CN12 |
| InChI | InChI=1S/C17H15NO.C15H17NO.2C2H6/c19-17-15-8-4-3-7-14(15)16-10-9-12-5-1-2-6-13(12)11-18(16)17;17-14-9-8-10-4-3-6-12-11-5-1-2-7-13(11)16(14)15(10)12;2*1-2/h1-8,16H,9-11H2;3-4,6,11,13H,1-2,5,7-9H2;2*1-2H3 |
| InChIKey | ZKHBSCGHQMJPRJ-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.76 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |