C9H20O7 — CID 162146221
4-(1,2-dihydroxyethyl)heptane-1,2,4,6,7-pentol (PubChem CID 162146221) has the molecular formula C9H20O7 and a molecular weight of 240.25 g/mol. Its IUPAC name is 4-(1,2-dihydroxyethyl)heptane-1,2,4,6,7-pentol.
| Compound Name | 4-(1,2-dihydroxyethyl)heptane-1,2,4,6,7-pentol |
|---|---|
| PubChem CID | 162146221 |
| Molecular Formula | C9H20O7 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 4-(1,2-dihydroxyethyl)heptane-1,2,4,6,7-pentol |
| SMILES | OCC(O)CC(O)(CC(O)CO)C(O)CO |
| InChI | InChI=1S/C9H20O7/c10-3-6(13)1-9(16,8(15)5-12)2-7(14)4-11/h6-8,10-16H,1-5H2 |
| InChIKey | ZKOYYXGNSWZOSM-UHFFFAOYSA-N |
| XLogP | -3.44 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |