C16H15N3O3 — CID 162147126
N-benzyl-1,2-oxazole-3-carboxamide;oxazepine (PubChem CID 162147126) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is N-benzyl-1,2-oxazole-3-carboxamide;oxazepine.
| Compound Name | N-benzyl-1,2-oxazole-3-carboxamide;oxazepine |
|---|---|
| PubChem CID | 162147126 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-benzyl-1,2-oxazole-3-carboxamide;oxazepine |
| SMILES | C1=CC=NOC=C1.O=C(NCc1ccccc1)c1ccon1 |
| InChI | InChI=1S/C11H10N2O2.C5H5NO/c14-11(10-6-7-15-13-10)12-8-9-4-2-1-3-5-9;1-2-4-6-7-5-3-1/h1-7H,8H2,(H,12,14);1-5H |
| InChIKey | ZKRYKTGHXALECJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |