C48H70N10O8S2 — CID 162147759
2-[4-[(2S)-4-[(6-amino-3-pyridinyl)sulfonyl]-2-[[(3S)-3-methylmorpholin-4-yl]methyl]piperazin-1-yl]phenyl]propan-2-ol (PubChem CID 162147759) has the molecular formula C48H70N10O8S2 and a molecular weight of 979.28 g/mol. Its IUPAC name is 2-[4-[(2S)-4-[(6-amino-3-pyridinyl)sulfonyl]-2-[[(3S)-3-methylmorpholin-4-yl]methyl]piperazin-1-yl]phenyl]propan-2-ol.
| Compound Name | 2-[4-[(2S)-4-[(6-amino-3-pyridinyl)sulfonyl]-2-[[(3S)-3-methylmorpholin-4-yl]methyl]piperazin-1-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 162147759 |
| Molecular Formula | C48H70N10O8S2 |
| Molecular Weight | 979.28 g/mol |
| Exact Mass | 978.48 |
| IUPAC Name | 2-[4-[(2S)-4-[(6-amino-3-pyridinyl)sulfonyl]-2-[[(3S)-3-methylmorpholin-4-yl]methyl]piperazin-1-yl]phenyl]propan-2-ol |
| SMILES | C[C@H]1COCCN1C[C@H]1CN(S(=O)(=O)c2ccc(N)nc2)CCN1c1ccc(C(C)(C)O)cc1.C[C@H]1COCCN1C[C@H]1CN(S(=O)(=O)c2ccc(N)nc2)CCN1c1ccc(C(C)(C)O)cc1 |
| InChI | InChI=1S/2C24H35N5O4S/c2*1-18-17-33-13-12-27(18)15-21-16-28(34(31,32)22-8-9-23(25)26-14-22)10-11-29(21)20-6-4-19(5-7-20)24(2,3)30/h2*4-9,14,18,21,30H,10-13,15-17H2,1-3H3,(H2,25,26)/t2*18-,21-/m00/s1 |
| InChIKey | ZKUFOCHAYOLNAN-LRFSZAJISA-N |
| XLogP | 2.98 |
| TPSA | 224.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 979.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|