About barium(2+);hydrogen carbonate;azide
barium(2+);hydrogen carbonate;azide (PubChem CID 162151656) has the molecular formula CHBaN3O3
and a molecular weight of 240.37 g/mol. Its IUPAC name is barium(2+);hydrogen carbonate;azide.
Molecular Properties
| Compound Name | barium(2+);hydrogen carbonate;azide |
| PubChem CID | 162151656 |
| Molecular Formula | CHBaN3O3 |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.91 |
| IUPAC Name | barium(2+);hydrogen carbonate;azide |
| SMILES | O=C([O-])O.[Ba+2].[N-]=[N+]=[N-] |
| InChI | InChI=1S/CH2O3.Ba.N3/c2-1(3)4;;1-3-2/h(H2,2,3,4);;/q;+2;-1/p-1 |
| InChIKey | ZLHFWPUNDLGUDQ-UHFFFAOYSA-M |
| XLogP | -0.63 |
| TPSA | 119.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);hydrogen carbonate;azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);hydrogen carbonate;azide?
The IUPAC name of barium(2+);hydrogen carbonate;azide (CID 162151656) is barium(2+);hydrogen carbonate;azide.
What is the SMILES notation for barium(2+);hydrogen carbonate;azide?
The canonical SMILES for barium(2+);hydrogen carbonate;azide is O=C([O-])O.[Ba+2].[N-]=[N+]=[N-].
What is the InChIKey of barium(2+);hydrogen carbonate;azide?
The InChIKey is ZLHFWPUNDLGUDQ-UHFFFAOYSA-M. The full InChI is InChI=1S/CH2O3.Ba.N3/c2-1(3)4;;1-3-2/h(H2,2,3,4);;/q;+2;-1/p-1.
What are the key properties of barium(2+);hydrogen carbonate;azide?
barium(2+);hydrogen carbonate;azide has a molecular weight of 240.37 g/mol, XLogP of -0.63, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);hydrogen carbonate;azide is sourced from PubChem (CID 162151656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).