C21H19ClNO5S+ — CID 162151844
[5-carbamoyl-2-[(4-chloro-2-ethoxycarbonyl-1-benzothiophen-3-yl)methoxy]-3-methylphenyl]-methylideneoxidanium (PubChem CID 162151844) has the molecular formula C21H19ClNO5S+ and a molecular weight of 432.91 g/mol. Its IUPAC name is [5-carbamoyl-2-[(4-chloro-2-ethoxycarbonyl-1-benzothiophen-3-yl)methoxy]-3-methylphenyl]-methylideneoxidanium.
| Compound Name | [5-carbamoyl-2-[(4-chloro-2-ethoxycarbonyl-1-benzothiophen-3-yl)methoxy]-3-methylphenyl]-methylideneoxidanium |
|---|---|
| PubChem CID | 162151844 |
| Molecular Formula | C21H19ClNO5S+ |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | [5-carbamoyl-2-[(4-chloro-2-ethoxycarbonyl-1-benzothiophen-3-yl)methoxy]-3-methylphenyl]-methylideneoxidanium |
| SMILES | C=[O+]c1cc(C(N)=O)cc(C)c1OCc1c(C(=O)OCC)sc2cccc(Cl)c12 |
| InChI | InChI=1S/C21H18ClNO5S/c1-4-27-21(25)19-13(17-14(22)6-5-7-16(17)29-19)10-28-18-11(2)8-12(20(23)24)9-15(18)26-3/h5-9H,3-4,10H2,1-2H3,(H-,23,24)/p+1 |
| InChIKey | MSWHERUKDZSSRZ-UHFFFAOYSA-O |
| XLogP | 4.80 |
| TPSA | 89.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|