C26H60N2O4Si2 — CID 162158714
N,N'-bis(3-diethoxysilylbutyl)decane-1,10-diamine (PubChem CID 162158714) has the molecular formula C26H60N2O4Si2 and a molecular weight of 520.95 g/mol. Its IUPAC name is N,N'-bis(3-diethoxysilylbutyl)decane-1,10-diamine.
| Compound Name | N,N'-bis(3-diethoxysilylbutyl)decane-1,10-diamine |
|---|---|
| PubChem CID | 162158714 |
| Molecular Formula | C26H60N2O4Si2 |
| Molecular Weight | 520.95 g/mol |
| Exact Mass | 520.41 |
| IUPAC Name | N,N'-bis(3-diethoxysilylbutyl)decane-1,10-diamine |
| SMILES | CCO[SiH](OCC)C(C)CCNCCCCCCCCCCNCCC(C)[SiH](OCC)OCC |
| InChI | InChI=1S/C26H60N2O4Si2/c1-7-29-33(30-8-2)25(5)19-23-27-21-17-15-13-11-12-14-16-18-22-28-24-20-26(6)34(31-9-3)32-10-4/h25-28,33-34H,7-24H2,1-6H3 |
| InChIKey | LGXRWAIERWUTOU-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.95 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|