C20H47NO5Si2 — CID 175408997
6-diethoxysilyl-N-(3-triethoxysilylpropyl)heptan-1-amine (PubChem CID 175408997) has the molecular formula C20H47NO5Si2 and a molecular weight of 437.77 g/mol. Its IUPAC name is 6-diethoxysilyl-N-(3-triethoxysilylpropyl)heptan-1-amine.
| Compound Name | 6-diethoxysilyl-N-(3-triethoxysilylpropyl)heptan-1-amine |
|---|---|
| PubChem CID | 175408997 |
| Molecular Formula | C20H47NO5Si2 |
| Molecular Weight | 437.77 g/mol |
| Exact Mass | 437.30 |
| IUPAC Name | 6-diethoxysilyl-N-(3-triethoxysilylpropyl)heptan-1-amine |
| SMILES | CCO[SiH](OCC)C(C)CCCCCNCCC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C20H47NO5Si2/c1-7-22-27(23-8-2)20(6)16-13-12-14-17-21-18-15-19-28(24-9-3,25-10-4)26-11-5/h20-21,27H,7-19H2,1-6H3 |
| InChIKey | KPQXLURQTMEGKN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.77 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|