C24H24BBr3FN3O2 — CID 162161258
N-(4-fluorophenyl)-4-[4-(4-hydroxy-3-methylphenyl)piperazin-1-yl]benzamide;tribromoborane (PubChem CID 162161258) has the molecular formula C24H24BBr3FN3O2 and a molecular weight of 656.00 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4-[4-(4-hydroxy-3-methylphenyl)piperazin-1-yl]benzamide;tribromoborane.
| Compound Name | N-(4-fluorophenyl)-4-[4-(4-hydroxy-3-methylphenyl)piperazin-1-yl]benzamide;tribromoborane |
|---|---|
| PubChem CID | 162161258 |
| Molecular Formula | C24H24BBr3FN3O2 |
| Molecular Weight | 656.00 g/mol |
| Exact Mass | 652.95 |
| IUPAC Name | N-(4-fluorophenyl)-4-[4-(4-hydroxy-3-methylphenyl)piperazin-1-yl]benzamide;tribromoborane |
| SMILES | BrB(Br)Br.Cc1cc(N2CCN(c3ccc(C(=O)Nc4ccc(F)cc4)cc3)CC2)ccc1O |
| InChI | InChI=1S/C24H24FN3O2.BBr3/c1-17-16-22(10-11-23(17)29)28-14-12-27(13-15-28)21-8-2-18(3-9-21)24(30)26-20-6-4-19(25)5-7-20;2-1(3)4/h2-11,16,29H,12-15H2,1H3,(H,26,30); |
| InChIKey | ZMNADYFQVBIMPZ-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.00 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|