C5H15N3O3 — CID 162162897
O-[1,3-bis(aminomethoxy)propan-2-yl]hydroxylamine (PubChem CID 162162897) has the molecular formula C5H15N3O3 and a molecular weight of 165.19 g/mol. Its IUPAC name is O-[1,3-bis(aminomethoxy)propan-2-yl]hydroxylamine.
| Compound Name | O-[1,3-bis(aminomethoxy)propan-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 162162897 |
| Molecular Formula | C5H15N3O3 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.11 |
| IUPAC Name | O-[1,3-bis(aminomethoxy)propan-2-yl]hydroxylamine |
| SMILES | NCOCC(COCN)ON |
| InChI | InChI=1S/C5H15N3O3/c6-3-9-1-5(11-8)2-10-4-7/h5H,1-4,6-8H2 |
| InChIKey | ZMSONLMELUCQSI-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 105.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|