C3H10N2O3 — CID 57423862
2,3-diaminooxypropan-1-ol (PubChem CID 57423862) has the molecular formula C3H10N2O3 and a molecular weight of 122.12 g/mol. Its IUPAC name is 2,3-diaminooxypropan-1-ol.
| Compound Name | 2,3-diaminooxypropan-1-ol |
|---|---|
| PubChem CID | 57423862 |
| Molecular Formula | C3H10N2O3 |
| Molecular Weight | 122.12 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | 2,3-diaminooxypropan-1-ol |
| SMILES | NOCC(CO)ON |
| InChI | InChI=1S/C3H10N2O3/c4-7-2-3(1-6)8-5/h3,6H,1-2,4-5H2 |
| InChIKey | JMCONPCMAIDWHR-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.12 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|