C6H16N2O6 — CID 89395567
(2R,3R,4R,5R)-1,6-diaminooxyhexane-2,3,4,5-tetrol (PubChem CID 89395567) has the molecular formula C6H16N2O6 and a molecular weight of 212.20 g/mol. Its IUPAC name is (2R,3R,4R,5R)-1,6-diaminooxyhexane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4R,5R)-1,6-diaminooxyhexane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 89395567 |
| Molecular Formula | C6H16N2O6 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (2R,3R,4R,5R)-1,6-diaminooxyhexane-2,3,4,5-tetrol |
| SMILES | NOC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CON |
| InChI | InChI=1S/C6H16N2O6/c7-13-1-3(9)5(11)6(12)4(10)2-14-8/h3-6,9-12H,1-2,7-8H2/t3-,4-,5-,6-/m1/s1 |
| InChIKey | IJQKXISEIRPINC-KVTDHHQDSA-N |
| XLogP | -3.79 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -3.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|