C6H14N2O7 — CID 87229005
3,6-diaminooxy-2,4,5-trihydroxyhexanoic acid (PubChem CID 87229005) has the molecular formula C6H14N2O7 and a molecular weight of 226.18 g/mol. Its IUPAC name is 3,6-diaminooxy-2,4,5-trihydroxyhexanoic acid.
| Compound Name | 3,6-diaminooxy-2,4,5-trihydroxyhexanoic acid |
|---|---|
| PubChem CID | 87229005 |
| Molecular Formula | C6H14N2O7 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 3,6-diaminooxy-2,4,5-trihydroxyhexanoic acid |
| SMILES | NOCC(O)C(O)C(ON)C(O)C(=O)O |
| InChI | InChI=1S/C6H14N2O7/c7-14-1-2(9)3(10)5(15-8)4(11)6(12)13/h2-5,9-11H,1,7-8H2,(H,12,13) |
| InChIKey | MPOWDVNBEDIPTR-UHFFFAOYSA-N |
| XLogP | -3.70 |
| TPSA | 168.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | -3.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|