(2R)-2-aminooxy-2-hydroxyacetic acid

C2H5NO4 — CID 90135688

IUPAC(2R)-2-aminooxy-2-hydroxyacetic acid
SMILESNO[C@@H](O)C(=O)O
InChIInChI=1S/C2H5NO4/c3-7-2(6)1(4)5/h2,6H,3H2,(H,4,5)/t2-/m1/s1
InChIKeySUKQRMRYZZJJAN-UWTATZPHSA-N
MW107.06 g/mol
LogP-1.72
Rot. Bonds2

About (2R)-2-aminooxy-2-hydroxyacetic acid

(2R)-2-aminooxy-2-hydroxyacetic acid (PubChem CID 90135688) has the molecular formula C2H5NO4 and a molecular weight of 107.06 g/mol. Its IUPAC name is (2R)-2-aminooxy-2-hydroxyacetic acid.

Molecular Properties

Compound Name(2R)-2-aminooxy-2-hydroxyacetic acid
PubChem CID90135688
Molecular FormulaC2H5NO4
Molecular Weight107.06 g/mol
Exact Mass107.02
IUPAC Name(2R)-2-aminooxy-2-hydroxyacetic acid
SMILESNO[C@@H](O)C(=O)O
InChIInChI=1S/C2H5NO4/c3-7-2(6)1(4)5/h2,6H,3H2,(H,4,5)/t2-/m1/s1
InChIKeySUKQRMRYZZJJAN-UWTATZPHSA-N
XLogP-1.72
TPSA92.78 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms7
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500107.06
LogP ≤ 5-1.72
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (2R)-2-aminooxy-2-hydroxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-aminooxy-2-hydroxyacetic acid?
The IUPAC name of (2R)-2-aminooxy-2-hydroxyacetic acid (CID 90135688) is (2R)-2-aminooxy-2-hydroxyacetic acid.
What is the SMILES notation for (2R)-2-aminooxy-2-hydroxyacetic acid?
The canonical SMILES for (2R)-2-aminooxy-2-hydroxyacetic acid is NO[C@@H](O)C(=O)O.
What is the InChIKey of (2R)-2-aminooxy-2-hydroxyacetic acid?
The InChIKey is SUKQRMRYZZJJAN-UWTATZPHSA-N. The full InChI is InChI=1S/C2H5NO4/c3-7-2(6)1(4)5/h2,6H,3H2,(H,4,5)/t2-/m1/s1.
What are the key properties of (2R)-2-aminooxy-2-hydroxyacetic acid?
(2R)-2-aminooxy-2-hydroxyacetic acid has a molecular weight of 107.06 g/mol, XLogP of -1.72, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-aminooxy-2-hydroxyacetic acid is sourced from PubChem (CID 90135688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).