C26H33ClI2N10O4 — CID 162167197
CID 162167197 (PubChem CID 162167197) has the molecular formula C26H33ClI2N10O4 and a molecular weight of 838.88 g/mol.
| Compound Name | CID 162167197 |
|---|---|
| PubChem CID | 162167197 |
| Molecular Formula | C26H33ClI2N10O4 |
| Molecular Weight | 838.88 g/mol |
| Exact Mass | 838.05 |
| IUPAC Name | — |
| SMILES | COc1ccc(Oc2cnc(N)nc2N)c(C(C)C)n1.COc1nc(C(C)C)c(Oc2cnc(N)nc2N)cc1I.ClI |
| InChI | InChI=1S/C13H16IN5O2.C13H17N5O2.ClI/c1-6(2)10-8(4-7(14)12(18-10)20-3)21-9-5-17-13(16)19-11(9)15;1-7(2)11-8(4-5-10(17-11)19-3)20-9-6-16-13(15)18-12(9)14;1-2/h4-6H,1-3H3,(H4,15,16,17,19);4-7H,1-3H3,(H4,14,15,16,18); |
| InChIKey | ZNHDZLLDUZFYMX-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 218.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.88 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|