About CID 162167197
CID 162167197 (PubChem CID 162167197) has the molecular formula C26H33ClI2N10O4
and a molecular weight of 838.88 g/mol.
Molecular Properties
| Compound Name | CID 162167197 |
| PubChem CID | 162167197 |
| Molecular Formula | C26H33ClI2N10O4 |
| Molecular Weight | 838.88 g/mol |
| Exact Mass | 838.05 |
| IUPAC Name | — |
| SMILES | COc1ccc(Oc2cnc(N)nc2N)c(C(C)C)n1.COc1nc(C(C)C)c(Oc2cnc(N)nc2N)cc1I.ClI |
| InChI | InChI=1S/C13H16IN5O2.C13H17N5O2.ClI/c1-6(2)10-8(4-7(14)12(18-10)20-3)21-9-5-17-13(16)19-11(9)15;1-7(2)11-8(4-5-10(17-11)19-3)20-9-6-16-13(15)18-12(9)14;1-2/h4-6H,1-3H3,(H4,15,16,17,19);4-7H,1-3H3,(H4,14,15,16,18); |
| InChIKey | ZNHDZLLDUZFYMX-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 218.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 838.88 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 162167197 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162167197?
The IUPAC name of CID 162167197 (CID 162167197) is not available.
What is the SMILES notation for CID 162167197?
The canonical SMILES for CID 162167197 is COc1ccc(Oc2cnc(N)nc2N)c(C(C)C)n1.COc1nc(C(C)C)c(Oc2cnc(N)nc2N)cc1I.ClI.
What is the InChIKey of CID 162167197?
The InChIKey is ZNHDZLLDUZFYMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16IN5O2.C13H17N5O2.ClI/c1-6(2)10-8(4-7(14)12(18-10)20-3)21-9-5-17-13(16)19-11(9)15;1-7(2)11-8(4-5-10(17-11)19-3)20-9-6-16-13(15)18-12(9)14;1-2/h4-6H,1-3H3,(H4,15,16,17,19);4-7H,1-3H3,(H4,14,15,16,18);.
What are the key properties of CID 162167197?
CID 162167197 has a molecular weight of 838.88 g/mol, XLogP of 6.10, 8 rotatable bonds, 4 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162167197 is sourced from PubChem (CID 162167197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).