About ethane;5-[(6-methoxy-5-methyl-2-propan-2-yl-3-pyridinyl)oxy]pyrimidine-2,4-diamine
ethane;5-[(6-methoxy-5-methyl-2-propan-2-yl-3-pyridinyl)oxy]pyrimidine-2,4-diamine (PubChem CID 145370745) has the molecular formula C16H25N5O2
and a molecular weight of 319.41 g/mol. Its IUPAC name is ethane;5-[(6-methoxy-5-methyl-2-propan-2-yl-3-pyridinyl)oxy]pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | ethane;5-[(6-methoxy-5-methyl-2-propan-2-yl-3-pyridinyl)oxy]pyrimidine-2,4-diamine |
| PubChem CID | 145370745 |
| Molecular Formula | C16H25N5O2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | ethane;5-[(6-methoxy-5-methyl-2-propan-2-yl-3-pyridinyl)oxy]pyrimidine-2,4-diamine |
| SMILES | CC.COc1nc(C(C)C)c(Oc2cnc(N)nc2N)cc1C |
| InChI | InChI=1S/C14H19N5O2.C2H6/c1-7(2)11-9(5-8(3)13(18-11)20-4)21-10-6-17-14(16)19-12(10)15;1-2/h5-7H,1-4H3,(H4,15,16,17,19);1-2H3 |
| InChIKey | ZSGJFWRUBUXGJC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 109.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethane;5-[(6-methoxy-5-methyl-2-propan-2-yl-3-pyridinyl)oxy]pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-[(6-methoxy-5-methyl-2-propan-2-yl-3-pyridinyl)oxy]pyrimidine-2,4-diamine?
The IUPAC name of ethane;5-[(6-methoxy-5-methyl-2-propan-2-yl-3-pyridinyl)oxy]pyrimidine-2,4-diamine (CID 145370745) is ethane;5-[(6-methoxy-5-methyl-2-propan-2-yl-3-pyridinyl)oxy]pyrimidine-2,4-diamine.
What is the SMILES notation for ethane;5-[(6-methoxy-5-methyl-2-propan-2-yl-3-pyridinyl)oxy]pyrimidine-2,4-diamine?
The canonical SMILES for ethane;5-[(6-methoxy-5-methyl-2-propan-2-yl-3-pyridinyl)oxy]pyrimidine-2,4-diamine is CC.COc1nc(C(C)C)c(Oc2cnc(N)nc2N)cc1C.
What is the InChIKey of ethane;5-[(6-methoxy-5-methyl-2-propan-2-yl-3-pyridinyl)oxy]pyrimidine-2,4-diamine?
The InChIKey is ZSGJFWRUBUXGJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N5O2.C2H6/c1-7(2)11-9(5-8(3)13(18-11)20-4)21-10-6-17-14(16)19-12(10)15;1-2/h5-7H,1-4H3,(H4,15,16,17,19);1-2H3.
What are the key properties of ethane;5-[(6-methoxy-5-methyl-2-propan-2-yl-3-pyridinyl)oxy]pyrimidine-2,4-diamine?
ethane;5-[(6-methoxy-5-methyl-2-propan-2-yl-3-pyridinyl)oxy]pyrimidine-2,4-diamine has a molecular weight of 319.41 g/mol, XLogP of 3.29, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-[(6-methoxy-5-methyl-2-propan-2-yl-3-pyridinyl)oxy]pyrimidine-2,4-diamine is sourced from PubChem (CID 145370745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).