C12H14N4O — CID 71212910
5-(2,5-dimethylphenoxy)pyrimidine-2,4-diamine (PubChem CID 71212910) has the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)pyrimidine-2,4-diamine.
| Compound Name | 5-(2,5-dimethylphenoxy)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 71212910 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)pyrimidine-2,4-diamine |
| SMILES | Cc1ccc(C)c(Oc2cnc(N)nc2N)c1 |
| InChI | InChI=1S/C12H14N4O/c1-7-3-4-8(2)9(5-7)17-10-6-15-12(14)16-11(10)13/h3-6H,1-2H3,(H4,13,14,15,16) |
| InChIKey | HOPFIYHBOHAKPX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |