C34H21F13 — CID 162171237
9-(9,10-dihydroanthracen-9-yl)-1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-9,10-dihydroanthracene (PubChem CID 162171237) has the molecular formula C34H21F13 and a molecular weight of 676.52 g/mol. Its IUPAC name is 9-(9,10-dihydroanthracen-9-yl)-1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-9,10-dihydroanthracene.
| Compound Name | 9-(9,10-dihydroanthracen-9-yl)-1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-9,10-dihydroanthracene |
|---|---|
| PubChem CID | 162171237 |
| Molecular Formula | C34H21F13 |
| Molecular Weight | 676.52 g/mol |
| Exact Mass | 676.14 |
| IUPAC Name | 9-(9,10-dihydroanthracen-9-yl)-1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-9,10-dihydroanthracene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c1cccc2c1C(C1c3ccccc3Cc3ccccc31)c1ccccc1C2 |
| InChI | InChI=1S/C34H21F13/c35-29(36,30(37,38)31(39,40)32(41,42)33(43,44)34(45,46)47)25-15-7-11-21-17-20-10-3-6-14-24(20)28(26(21)25)27-22-12-4-1-8-18(22)16-19-9-2-5-13-23(19)27/h1-15,27-28H,16-17H2 |
| InChIKey | ZNUXERGDDHTXFX-UHFFFAOYSA-N |
| XLogP | 10.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.52 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|