C50H49N5O8 — CID 162172843
2-(4-benzoyl-2-methylpiperazin-1-yl)acetonitrile;1-(4-benzoyl-2-methylpiperazin-1-yl)-2-[4-(furan-2-yl)phenyl]ethane-1,2-dione;methyl 4-(furan-2-yl)benzoate (PubChem CID 162172843) has the molecular formula C50H49N5O8 and a molecular weight of 847.97 g/mol. Its IUPAC name is 2-(4-benzoyl-2-methylpiperazin-1-yl)acetonitrile;1-(4-benzoyl-2-methylpiperazin-1-yl)-2-[4-(furan-2-yl)phenyl]ethane-1,2-dione;methyl 4-(furan-2-yl)benzoate.
| Compound Name | 2-(4-benzoyl-2-methylpiperazin-1-yl)acetonitrile;1-(4-benzoyl-2-methylpiperazin-1-yl)-2-[4-(furan-2-yl)phenyl]ethane-1,2-dione;methyl 4-(furan-2-yl)benzoate |
|---|---|
| PubChem CID | 162172843 |
| Molecular Formula | C50H49N5O8 |
| Molecular Weight | 847.97 g/mol |
| Exact Mass | 847.36 |
| IUPAC Name | 2-(4-benzoyl-2-methylpiperazin-1-yl)acetonitrile;1-(4-benzoyl-2-methylpiperazin-1-yl)-2-[4-(furan-2-yl)phenyl]ethane-1,2-dione;methyl 4-(furan-2-yl)benzoate |
| SMILES | CC1CN(C(=O)c2ccccc2)CCN1C(=O)C(=O)c1ccc(-c2ccco2)cc1.CC1CN(C(=O)c2ccccc2)CCN1CC#N.COC(=O)c1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C24H22N2O4.C14H17N3O.C12H10O3/c1-17-16-25(23(28)20-6-3-2-4-7-20)13-14-26(17)24(29)22(27)19-11-9-18(10-12-19)21-8-5-15-30-21;1-12-11-17(10-9-16(12)8-7-15)14(18)13-5-3-2-4-6-13;1-14-12(13)10-6-4-9(5-7-10)11-3-2-8-15-11/h2-12,15,17H,13-14,16H2,1H3;2-6,12H,8-11H2,1H3;2-8H,1H3 |
| InChIKey | ZNZZBHWGXXXHFZ-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 157.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.97 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|