C24H24N4O4 — CID 74382692
1-[4-(N-methoxy-C-phenylcarbonimidoyl)-2-methylpiperazin-1-yl]-2-[4-(1,3-oxazol-5-yl)phenyl]ethane-1,2-dione (PubChem CID 74382692) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is 1-[4-(N-methoxy-C-phenylcarbonimidoyl)-2-methylpiperazin-1-yl]-2-[4-(1,3-oxazol-5-yl)phenyl]ethane-1,2-dione.
| Compound Name | 1-[4-(N-methoxy-C-phenylcarbonimidoyl)-2-methylpiperazin-1-yl]-2-[4-(1,3-oxazol-5-yl)phenyl]ethane-1,2-dione |
|---|---|
| PubChem CID | 74382692 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 1-[4-(N-methoxy-C-phenylcarbonimidoyl)-2-methylpiperazin-1-yl]-2-[4-(1,3-oxazol-5-yl)phenyl]ethane-1,2-dione |
| SMILES | CON=C(c1ccccc1)N1CCN(C(=O)C(=O)c2ccc(-c3cnco3)cc2)C(C)C1 |
| InChI | InChI=1S/C24H24N4O4/c1-17-15-27(23(26-31-2)20-6-4-3-5-7-20)12-13-28(17)24(30)22(29)19-10-8-18(9-11-19)21-14-25-16-32-21/h3-11,14,16-17H,12-13,15H2,1-2H3 |
| InChIKey | SQEPZAZLBPMRQK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|