C27H29N3 — CID 162173574
4-[bis(4-aminophenyl)methyl]-N,N-diethylnaphthalen-1-amine (PubChem CID 162173574) has the molecular formula C27H29N3 and a molecular weight of 395.55 g/mol. Its IUPAC name is 4-[bis(4-aminophenyl)methyl]-N,N-diethylnaphthalen-1-amine.
| Compound Name | 4-[bis(4-aminophenyl)methyl]-N,N-diethylnaphthalen-1-amine |
|---|---|
| PubChem CID | 162173574 |
| Molecular Formula | C27H29N3 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 4-[bis(4-aminophenyl)methyl]-N,N-diethylnaphthalen-1-amine |
| SMILES | CCN(CC)c1ccc(C(c2ccc(N)cc2)c2ccc(N)cc2)c2ccccc12 |
| InChI | InChI=1S/C27H29N3/c1-3-30(4-2)26-18-17-25(23-7-5-6-8-24(23)26)27(19-9-13-21(28)14-10-19)20-11-15-22(29)16-12-20/h5-18,27H,3-4,28-29H2,1-2H3 |
| InChIKey | PZEYUIQTNGZFRP-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|