C33H42ClN3 — CID 70544608
4-[bis[4-(diethylamino)phenyl]methyl]-N-ethylnaphthalen-1-amine;hydrochloride (PubChem CID 70544608) has the molecular formula C33H42ClN3 and a molecular weight of 516.17 g/mol. Its IUPAC name is 4-[bis[4-(diethylamino)phenyl]methyl]-N-ethylnaphthalen-1-amine;hydrochloride.
| Compound Name | 4-[bis[4-(diethylamino)phenyl]methyl]-N-ethylnaphthalen-1-amine;hydrochloride |
|---|---|
| PubChem CID | 70544608 |
| Molecular Formula | C33H42ClN3 |
| Molecular Weight | 516.17 g/mol |
| Exact Mass | 515.31 |
| IUPAC Name | 4-[bis[4-(diethylamino)phenyl]methyl]-N-ethylnaphthalen-1-amine;hydrochloride |
| SMILES | CCNc1ccc(C(c2ccc(N(CC)CC)cc2)c2ccc(N(CC)CC)cc2)c2ccccc12.Cl |
| InChI | InChI=1S/C33H41N3.ClH/c1-6-34-32-24-23-31(29-13-11-12-14-30(29)32)33(25-15-19-27(20-16-25)35(7-2)8-3)26-17-21-28(22-18-26)36(9-4)10-5;/h11-24,33-34H,6-10H2,1-5H3;1H |
| InChIKey | JQKADGRJICCXJW-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.17 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|