C39H50N2O2 — CID 122434063
5-[[4-[[4-(diethylamino)phenyl]-(4-methylphenyl)methyl]naphthalen-1-yl]amino]pentyl 2,2-dimethylbutanoate (PubChem CID 122434063) has the molecular formula C39H50N2O2 and a molecular weight of 578.84 g/mol. Its IUPAC name is 5-[[4-[[4-(diethylamino)phenyl]-(4-methylphenyl)methyl]naphthalen-1-yl]amino]pentyl 2,2-dimethylbutanoate.
| Compound Name | 5-[[4-[[4-(diethylamino)phenyl]-(4-methylphenyl)methyl]naphthalen-1-yl]amino]pentyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 122434063 |
| Molecular Formula | C39H50N2O2 |
| Molecular Weight | 578.84 g/mol |
| Exact Mass | 578.39 |
| IUPAC Name | 5-[[4-[[4-(diethylamino)phenyl]-(4-methylphenyl)methyl]naphthalen-1-yl]amino]pentyl 2,2-dimethylbutanoate |
| SMILES | CCN(CC)c1ccc(C(c2ccc(C)cc2)c2ccc(NCCCCCOC(=O)C(C)(C)CC)c3ccccc23)cc1 |
| InChI | InChI=1S/C39H50N2O2/c1-7-39(5,6)38(42)43-28-14-10-13-27-40-36-26-25-35(33-15-11-12-16-34(33)36)37(30-19-17-29(4)18-20-30)31-21-23-32(24-22-31)41(8-2)9-3/h11-12,15-26,37,40H,7-10,13-14,27-28H2,1-6H3 |
| InChIKey | IWOCZLBKHLBNBF-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.84 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|