C40H50N2O2 — CID 161306383
6-[[4-[[4-(diethylamino)phenyl]-(4-methylphenyl)methylidene]naphthalen-1-ylidene]amino]hexyl 2,2-dimethylbutanoate (PubChem CID 161306383) has the molecular formula C40H50N2O2 and a molecular weight of 590.85 g/mol. Its IUPAC name is 6-[[4-[[4-(diethylamino)phenyl]-(4-methylphenyl)methylidene]naphthalen-1-ylidene]amino]hexyl 2,2-dimethylbutanoate.
| Compound Name | 6-[[4-[[4-(diethylamino)phenyl]-(4-methylphenyl)methylidene]naphthalen-1-ylidene]amino]hexyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 161306383 |
| Molecular Formula | C40H50N2O2 |
| Molecular Weight | 590.85 g/mol |
| Exact Mass | 590.39 |
| IUPAC Name | 6-[[4-[[4-(diethylamino)phenyl]-(4-methylphenyl)methylidene]naphthalen-1-ylidene]amino]hexyl 2,2-dimethylbutanoate |
| SMILES | CCN(CC)c1ccc(C(=C2C=C/C(=N\CCCCCCOC(=O)C(C)(C)CC)c3ccccc32)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C40H50N2O2/c1-7-40(5,6)39(43)44-29-15-11-10-14-28-41-37-27-26-36(34-16-12-13-17-35(34)37)38(31-20-18-30(4)19-21-31)32-22-24-33(25-23-32)42(8-2)9-3/h12-13,16-27H,7-11,14-15,28-29H2,1-6H3/b38-36?,41-37+ |
| InChIKey | UPVIFSPQQQGONF-JLUFAVGLSA-N |
| XLogP | 9.70 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.85 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|