C76H86N6O7S2 — CID 170854156
bis(4-[[4-(diethylamino)phenyl]-(4-ethyliminonaphthalen-1-ylidene)methyl]-N,N-diethylaniline);3-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 170854156) has the molecular formula C76H86N6O7S2 and a molecular weight of 1259.69 g/mol. Its IUPAC name is bis(4-[[4-(diethylamino)phenyl]-(4-ethyliminonaphthalen-1-ylidene)methyl]-N,N-diethylaniline);3-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | bis(4-[[4-(diethylamino)phenyl]-(4-ethyliminonaphthalen-1-ylidene)methyl]-N,N-diethylaniline);3-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 170854156 |
| Molecular Formula | C76H86N6O7S2 |
| Molecular Weight | 1259.69 g/mol |
| Exact Mass | 1258.60 |
| IUPAC Name | bis(4-[[4-(diethylamino)phenyl]-(4-ethyliminonaphthalen-1-ylidene)methyl]-N,N-diethylaniline);3-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | CC/N=C1\C=CC(=C(c2ccc(N(CC)CC)cc2)c2ccc(N(CC)CC)cc2)c2ccccc21.CC/N=C1\C=CC(=C(c2ccc(N(CC)CC)cc2)c2ccc(N(CC)CC)cc2)c2ccccc21.O=S(=O)(O)c1ccc2cc(O)c(S(=O)(=O)O)cc2c1 |
| InChI | InChI=1S/2C33H39N3.C10H8O7S2/c2*1-6-34-32-24-23-31(29-13-11-12-14-30(29)32)33(25-15-19-27(20-16-25)35(7-2)8-3)26-17-21-28(22-18-26)36(9-4)10-5;11-9-4-6-1-2-8(18(12,13)14)3-7(6)5-10(9)19(15,16)17/h2*11-24H,6-10H2,1-5H3;1-5,11H,(H,12,13,14)(H,15,16,17)/b2*34-32+; |
| InChIKey | IZHWQVASABOCMH-CVLOTWGZSA-N |
| XLogP | 16.47 |
| TPSA | 166.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 91 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1259.69 |
| LogP ≤ 5 | 16.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|