C36H34N2 — CID 159806073
4-[[4-(4-ethenylphenyl)iminonaphthalen-1-ylidene]-(4-methylphenyl)methyl]-N,N-diethylaniline (PubChem CID 159806073) has the molecular formula C36H34N2 and a molecular weight of 494.68 g/mol. Its IUPAC name is 4-[[4-(4-ethenylphenyl)iminonaphthalen-1-ylidene]-(4-methylphenyl)methyl]-N,N-diethylaniline.
| Compound Name | 4-[[4-(4-ethenylphenyl)iminonaphthalen-1-ylidene]-(4-methylphenyl)methyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 159806073 |
| Molecular Formula | C36H34N2 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | 4-[[4-(4-ethenylphenyl)iminonaphthalen-1-ylidene]-(4-methylphenyl)methyl]-N,N-diethylaniline |
| SMILES | C=Cc1ccc(/N=C2\C=CC(=C(c3ccc(C)cc3)c3ccc(N(CC)CC)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C36H34N2/c1-5-27-14-20-30(21-15-27)37-35-25-24-34(32-10-8-9-11-33(32)35)36(28-16-12-26(4)13-17-28)29-18-22-31(23-19-29)38(6-2)7-3/h5,8-25H,1,6-7H2,2-4H3/b36-34?,37-35+ |
| InChIKey | QHJKHZIDKOVZCL-XYCGZJHESA-N |
| XLogP | 9.13 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|