C34H33N3 — CID 21123860
4-[[4-(dimethylamino)phenyl]-[2-(4-methylphenyl)iminonaphthalen-1-ylidene]methyl]-N,N-dimethylaniline (PubChem CID 21123860) has the molecular formula C34H33N3 and a molecular weight of 483.66 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)phenyl]-[2-(4-methylphenyl)iminonaphthalen-1-ylidene]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[4-(dimethylamino)phenyl]-[2-(4-methylphenyl)iminonaphthalen-1-ylidene]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 21123860 |
| Molecular Formula | C34H33N3 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | 4-[[4-(dimethylamino)phenyl]-[2-(4-methylphenyl)iminonaphthalen-1-ylidene]methyl]-N,N-dimethylaniline |
| SMILES | Cc1ccc(/N=C2\C=Cc3ccccc3C2=C(c2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C34H33N3/c1-24-10-17-28(18-11-24)35-32-23-16-25-8-6-7-9-31(25)34(32)33(26-12-19-29(20-13-26)36(2)3)27-14-21-30(22-15-27)37(4)5/h6-23H,1-5H3/b35-32+ |
| InChIKey | GYTXWSFQILJLEI-LVYIWIAJSA-N |
| XLogP | 7.89 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|