C33H41N4+ — CID 121442993
[(4Z)-4-[[4-[2-aminoethyl(ethyl)amino]phenyl]-[4-(diethylamino)phenyl]methylidene]naphthalen-1-ylidene]-ethylazanium (PubChem CID 121442993) has the molecular formula C33H41N4+ and a molecular weight of 493.72 g/mol. Its IUPAC name is [(4Z)-4-[[4-[2-aminoethyl(ethyl)amino]phenyl]-[4-(diethylamino)phenyl]methylidene]naphthalen-1-ylidene]-ethylazanium.
| Compound Name | [(4Z)-4-[[4-[2-aminoethyl(ethyl)amino]phenyl]-[4-(diethylamino)phenyl]methylidene]naphthalen-1-ylidene]-ethylazanium |
|---|---|
| PubChem CID | 121442993 |
| Molecular Formula | C33H41N4+ |
| Molecular Weight | 493.72 g/mol |
| Exact Mass | 493.33 |
| IUPAC Name | [(4Z)-4-[[4-[2-aminoethyl(ethyl)amino]phenyl]-[4-(diethylamino)phenyl]methylidene]naphthalen-1-ylidene]-ethylazanium |
| SMILES | CC/[NH+]=C1\C=C/C(=C(\c2ccc(N(CC)CC)cc2)c2ccc(N(CC)CCN)cc2)c2ccccc21 |
| InChI | InChI=1S/C33H40N4/c1-5-35-32-22-21-31(29-11-9-10-12-30(29)32)33(25-13-17-27(18-14-25)36(6-2)7-3)26-15-19-28(20-16-26)37(8-4)24-23-34/h9-22H,5-8,23-24,34H2,1-4H3/p+1/b33-31-,35-32+ |
| InChIKey | HKLXKSFQCHUGMB-GCPZDNCSSA-O |
| XLogP | 4.74 |
| TPSA | 46.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.72 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|