C35H44N3+ — CID 135133908
[4-[bis[4-(diethylamino)-2-methylphenyl]methylidene]naphthalen-1-ylidene]-ethylazanium (PubChem CID 135133908) has the molecular formula C35H44N3+ and a molecular weight of 506.76 g/mol. Its IUPAC name is [4-[bis[4-(diethylamino)-2-methylphenyl]methylidene]naphthalen-1-ylidene]-ethylazanium.
| Compound Name | [4-[bis[4-(diethylamino)-2-methylphenyl]methylidene]naphthalen-1-ylidene]-ethylazanium |
|---|---|
| PubChem CID | 135133908 |
| Molecular Formula | C35H44N3+ |
| Molecular Weight | 506.76 g/mol |
| Exact Mass | 506.35 |
| IUPAC Name | [4-[bis[4-(diethylamino)-2-methylphenyl]methylidene]naphthalen-1-ylidene]-ethylazanium |
| SMILES | CC/[NH+]=C1\C=CC(=C(c2ccc(N(CC)CC)cc2C)c2ccc(N(CC)CC)cc2C)c2ccccc21 |
| InChI | InChI=1S/C35H43N3/c1-8-36-34-22-21-33(31-15-13-14-16-32(31)34)35(29-19-17-27(23-25(29)6)37(9-2)10-3)30-20-18-28(24-26(30)7)38(11-4)12-5/h13-24H,8-12H2,1-7H3/p+1/b36-34+ |
| InChIKey | KFNKEXLMYOOBSQ-JMUUFCRMSA-O |
| XLogP | 6.41 |
| TPSA | 20.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.76 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|