C34H39F3N4O4S2 — CID 140729154
[5-(diethylamino)-2-[(E)-[4-(diethylamino)phenyl]-(4-ethylazaniumylidenenaphthalen-1-ylidene)methyl]phenyl]sulfonyl-(trifluoromethylsulfonyl)azanide (PubChem CID 140729154) has the molecular formula C34H39F3N4O4S2 and a molecular weight of 688.84 g/mol. Its IUPAC name is [5-(diethylamino)-2-[(E)-[4-(diethylamino)phenyl]-(4-ethylazaniumylidenenaphthalen-1-ylidene)methyl]phenyl]sulfonyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | [5-(diethylamino)-2-[(E)-[4-(diethylamino)phenyl]-(4-ethylazaniumylidenenaphthalen-1-ylidene)methyl]phenyl]sulfonyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 140729154 |
| Molecular Formula | C34H39F3N4O4S2 |
| Molecular Weight | 688.84 g/mol |
| Exact Mass | 688.24 |
| IUPAC Name | [5-(diethylamino)-2-[(E)-[4-(diethylamino)phenyl]-(4-ethylazaniumylidenenaphthalen-1-ylidene)methyl]phenyl]sulfonyl-(trifluoromethylsulfonyl)azanide |
| SMILES | CC/[NH+]=C1\C=C/C(=C(/c2ccc(N(CC)CC)cc2)c2ccc(N(CC)CC)cc2S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C34H38F3N4O4S2/c1-6-38-31-22-21-29(27-13-11-12-14-28(27)31)33(24-15-17-25(18-16-24)40(7-2)8-3)30-20-19-26(41(9-4)10-5)23-32(30)46(42,43)39-47(44,45)34(35,36)37/h11-23H,6-10H2,1-5H3/q-1/p+1/b33-29+,38-31+ |
| InChIKey | WSAVIYQFHUYBFJ-BHEUNZCNSA-O |
| XLogP | 5.71 |
| TPSA | 102.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.84 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|