C38H45BrN3O3+ — CID 58160750
[(4E)-4-[[4-[2-acetyloxyethyl(ethyl)amino]phenyl]-[2-bromo-4-[2-ethoxyethyl(ethyl)amino]phenyl]methylidene]naphthalen-1-ylidene]-prop-2-enylazanium (PubChem CID 58160750) has the molecular formula C38H45BrN3O3+ and a molecular weight of 671.70 g/mol. Its IUPAC name is [(4E)-4-[[4-[2-acetyloxyethyl(ethyl)amino]phenyl]-[2-bromo-4-[2-ethoxyethyl(ethyl)amino]phenyl]methylidene]naphthalen-1-ylidene]-prop-2-enylazanium.
| Compound Name | [(4E)-4-[[4-[2-acetyloxyethyl(ethyl)amino]phenyl]-[2-bromo-4-[2-ethoxyethyl(ethyl)amino]phenyl]methylidene]naphthalen-1-ylidene]-prop-2-enylazanium |
|---|---|
| PubChem CID | 58160750 |
| Molecular Formula | C38H45BrN3O3+ |
| Molecular Weight | 671.70 g/mol |
| Exact Mass | 670.26 |
| IUPAC Name | [(4E)-4-[[4-[2-acetyloxyethyl(ethyl)amino]phenyl]-[2-bromo-4-[2-ethoxyethyl(ethyl)amino]phenyl]methylidene]naphthalen-1-ylidene]-prop-2-enylazanium |
| SMILES | C=CC/[NH+]=C1\C=C/C(=C(/c2ccc(N(CC)CCOC(C)=O)cc2)c2ccc(N(CC)CCOCC)cc2Br)c2ccccc21 |
| InChI | InChI=1S/C38H44BrN3O3/c1-6-22-40-37-21-20-34(32-12-10-11-13-33(32)37)38(29-14-16-30(17-15-29)41(7-2)24-26-45-28(5)43)35-19-18-31(27-36(35)39)42(8-3)23-25-44-9-4/h6,10-21,27H,1,7-9,22-26H2,2-5H3/p+1/b38-34+,40-37+ |
| InChIKey | YUNOBRVBMMOANN-JLVBLANASA-O |
| XLogP | 6.29 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.70 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|