C34H41N3 — CID 58160761
4-[(E)-[4-(diethylamino)phenyl]-(4-ethyliminonaphthalen-1-ylidene)methyl]-N,N-diethyl-3-methylaniline (PubChem CID 58160761) has the molecular formula C34H41N3 and a molecular weight of 491.72 g/mol. Its IUPAC name is 4-[(E)-[4-(diethylamino)phenyl]-(4-ethyliminonaphthalen-1-ylidene)methyl]-N,N-diethyl-3-methylaniline.
| Compound Name | 4-[(E)-[4-(diethylamino)phenyl]-(4-ethyliminonaphthalen-1-ylidene)methyl]-N,N-diethyl-3-methylaniline |
|---|---|
| PubChem CID | 58160761 |
| Molecular Formula | C34H41N3 |
| Molecular Weight | 491.72 g/mol |
| Exact Mass | 491.33 |
| IUPAC Name | 4-[(E)-[4-(diethylamino)phenyl]-(4-ethyliminonaphthalen-1-ylidene)methyl]-N,N-diethyl-3-methylaniline |
| SMILES | CC/N=C1\C=C/C(=C(/c2ccc(N(CC)CC)cc2)c2ccc(N(CC)CC)cc2C)c2ccccc21 |
| InChI | InChI=1S/C34H41N3/c1-7-35-33-23-22-32(30-14-12-13-15-31(30)33)34(26-16-18-27(19-17-26)36(8-2)9-3)29-21-20-28(24-25(29)6)37(10-4)11-5/h12-24H,7-11H2,1-6H3/b34-32+,35-33+ |
| InChIKey | CKLXOEYTJGZKSF-XUXOKTBYSA-N |
| XLogP | 8.03 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.72 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|