C30H32N2 — CID 129106321
N,N-diethyl-4-[(4-ethyliminocyclohexa-2,5-dien-1-ylidene)-naphthalen-1-ylmethyl]-3-methylaniline (PubChem CID 129106321) has the molecular formula C30H32N2 and a molecular weight of 420.60 g/mol. Its IUPAC name is N,N-diethyl-4-[(4-ethyliminocyclohexa-2,5-dien-1-ylidene)-naphthalen-1-ylmethyl]-3-methylaniline.
| Compound Name | N,N-diethyl-4-[(4-ethyliminocyclohexa-2,5-dien-1-ylidene)-naphthalen-1-ylmethyl]-3-methylaniline |
|---|---|
| PubChem CID | 129106321 |
| Molecular Formula | C30H32N2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | N,N-diethyl-4-[(4-ethyliminocyclohexa-2,5-dien-1-ylidene)-naphthalen-1-ylmethyl]-3-methylaniline |
| SMILES | CCN=C1C=CC(=C(c2ccc(N(CC)CC)cc2C)c2cccc3ccccc23)C=C1 |
| InChI | InChI=1S/C30H32N2/c1-5-31-25-17-15-24(16-18-25)30(29-14-10-12-23-11-8-9-13-28(23)29)27-20-19-26(21-22(27)4)32(6-2)7-3/h8-21H,5-7H2,1-4H3/b30-24-,31-25+ |
| InChIKey | LKFTYURXELOAQK-LQAAPGBJSA-N |
| XLogP | 7.38 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|